C18H17Cl2NO3 — CID 10133470
3-(3,5-dichloroanilino)-5-(3-methoxyphenyl)-5-methyloxolan-2-one (PubChem CID 10133470) has the molecular formula C18H17Cl2NO3 and a molecular weight of 366.24 g/mol. Its IUPAC name is 3-(3,5-dichloroanilino)-5-(3-methoxyphenyl)-5-methyloxolan-2-one.
| Compound Name | 3-(3,5-dichloroanilino)-5-(3-methoxyphenyl)-5-methyloxolan-2-one |
|---|---|
| PubChem CID | 10133470 |
| Molecular Formula | C18H17Cl2NO3 |
| Molecular Weight | 366.24 g/mol |
| Exact Mass | 365.06 |
| IUPAC Name | 3-(3,5-dichloroanilino)-5-(3-methoxyphenyl)-5-methyloxolan-2-one |
| SMILES | COc1cccc(C2(C)CC(Nc3cc(Cl)cc(Cl)c3)C(=O)O2)c1 |
| InChI | InChI=1S/C18H17Cl2NO3/c1-18(11-4-3-5-15(6-11)23-2)10-16(17(22)24-18)21-14-8-12(19)7-13(20)9-14/h3-9,16,21H,10H2,1-2H3 |
| InChIKey | NQZDFJWPQJORPI-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.24 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |