C13H14O4 — CID 175525500
4-(3-methoxyphenyl)-4-methyl-5-methylidene-1,3-dioxan-2-one (PubChem CID 175525500) has the molecular formula C13H14O4 and a molecular weight of 234.25 g/mol. Its IUPAC name is 4-(3-methoxyphenyl)-4-methyl-5-methylidene-1,3-dioxan-2-one.
| Compound Name | 4-(3-methoxyphenyl)-4-methyl-5-methylidene-1,3-dioxan-2-one |
|---|---|
| PubChem CID | 175525500 |
| Molecular Formula | C13H14O4 |
| Molecular Weight | 234.25 g/mol |
| Exact Mass | 234.09 |
| IUPAC Name | 4-(3-methoxyphenyl)-4-methyl-5-methylidene-1,3-dioxan-2-one |
| SMILES | C=C1COC(=O)OC1(C)c1cccc(OC)c1 |
| InChI | InChI=1S/C13H14O4/c1-9-8-16-12(14)17-13(9,2)10-5-4-6-11(7-10)15-3/h4-7H,1,8H2,2-3H3 |
| InChIKey | NXDWKXULTNZSTD-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.25 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|