C17H23NO3 — CID 21425372
3-(3-methoxyphenyl)-4,4-dimethyl-3-propylpiperidine-2,6-dione (PubChem CID 21425372) has the molecular formula C17H23NO3 and a molecular weight of 289.38 g/mol. Its IUPAC name is 3-(3-methoxyphenyl)-4,4-dimethyl-3-propylpiperidine-2,6-dione.
| Compound Name | 3-(3-methoxyphenyl)-4,4-dimethyl-3-propylpiperidine-2,6-dione |
|---|---|
| PubChem CID | 21425372 |
| Molecular Formula | C17H23NO3 |
| Molecular Weight | 289.38 g/mol |
| Exact Mass | 289.17 |
| IUPAC Name | 3-(3-methoxyphenyl)-4,4-dimethyl-3-propylpiperidine-2,6-dione |
| SMILES | CCCC1(c2cccc(OC)c2)C(=O)NC(=O)CC1(C)C |
| InChI | InChI=1S/C17H23NO3/c1-5-9-17(12-7-6-8-13(10-12)21-4)15(20)18-14(19)11-16(17,2)3/h6-8,10H,5,9,11H2,1-4H3,(H,18,19,20) |
| InChIKey | KVYYQQZTWJUJRJ-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.38 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|