C21H30N4 — CID 101335310
(2R)-N-benzyl-2-(4-phenylpiperazin-1-yl)butane-1,4-diamine (PubChem CID 101335310) has the molecular formula C21H30N4 and a molecular weight of 338.50 g/mol. Its IUPAC name is (2R)-N-benzyl-2-(4-phenylpiperazin-1-yl)butane-1,4-diamine.
| Compound Name | (2R)-N-benzyl-2-(4-phenylpiperazin-1-yl)butane-1,4-diamine |
|---|---|
| PubChem CID | 101335310 |
| Molecular Formula | C21H30N4 |
| Molecular Weight | 338.50 g/mol |
| Exact Mass | 338.25 |
| IUPAC Name | (2R)-N-benzyl-2-(4-phenylpiperazin-1-yl)butane-1,4-diamine |
| SMILES | NCC[C@H](CNCc1ccccc1)N1CCN(c2ccccc2)CC1 |
| InChI | InChI=1S/C21H30N4/c22-12-11-21(18-23-17-19-7-3-1-4-8-19)25-15-13-24(14-16-25)20-9-5-2-6-10-20/h1-10,21,23H,11-18,22H2/t21-/m1/s1 |
| InChIKey | PXDVJMJIJMOVSE-OAQYLSRUSA-N |
| XLogP | 2.32 |
| TPSA | 44.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.50 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |