C35H48FNO10 — CID 101336884
[(2S,3S,4R,5R)-5-[(3R)-3-[(2R,3R,4R)-4-fluoro-3-hydroxypyrrolidin-2-yl]-2,3-dihydroxypropyl]-2-(9-methoxy-9-oxononoxy)-4-phenylmethoxyoxolan-3-yl] benzoate (PubChem CID 101336884) has the molecular formula C35H48FNO10 and a molecular weight of 661.76 g/mol. Its IUPAC name is [(2S,3S,4R,5R)-5-[(3R)-3-[(2R,3R,4R)-4-fluoro-3-hydroxypyrrolidin-2-yl]-2,3-dihydroxypropyl]-2-(9-methoxy-9-oxononoxy)-4-phenylmethoxyoxolan-3-yl] benzoate.
| Compound Name | [(2S,3S,4R,5R)-5-[(3R)-3-[(2R,3R,4R)-4-fluoro-3-hydroxypyrrolidin-2-yl]-2,3-dihydroxypropyl]-2-(9-methoxy-9-oxononoxy)-4-phenylmethoxyoxolan-3-yl] benzoate |
|---|---|
| PubChem CID | 101336884 |
| Molecular Formula | C35H48FNO10 |
| Molecular Weight | 661.76 g/mol |
| Exact Mass | 661.33 |
| IUPAC Name | [(2S,3S,4R,5R)-5-[(3R)-3-[(2R,3R,4R)-4-fluoro-3-hydroxypyrrolidin-2-yl]-2,3-dihydroxypropyl]-2-(9-methoxy-9-oxononoxy)-4-phenylmethoxyoxolan-3-yl] benzoate |
| SMILES | COC(=O)CCCCCCCCO[C@H]1O[C@H](CC(O)[C@H](O)[C@H]2NC[C@@H](F)[C@@H]2O)[C@@H](OCc2ccccc2)[C@@H]1OC(=O)c1ccccc1 |
| InChI | InChI=1S/C35H48FNO10/c1-43-28(39)18-12-4-2-3-5-13-19-44-35-33(47-34(42)24-16-10-7-11-17-24)32(45-22-23-14-8-6-9-15-23)27(46-35)20-26(38)31(41)29-30(40)25(36)21-37-29/h6-11,14-17,25-27,29-33,35,37-38,40-41H,2-5,12-13,18-22H2,1H3/t25-,26?,27-,29+,30+,31+,32-,33+,35+/m1/s1 |
| InChIKey | GOBRJEXUNUNGTE-IDDWLMFKSA-N |
| XLogP | 3.23 |
| TPSA | 153.01 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 661.76 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|