C17H24O2 — CID 101337614
(1R,4R,5S,6R)-6-but-3-enyl-1-methyl-4-prop-1-en-2-yl-5-prop-2-enyl-7-oxabicyclo[4.1.0]heptan-2-one (PubChem CID 101337614) has the molecular formula C17H24O2 and a molecular weight of 260.38 g/mol. Its IUPAC name is (1R,4R,5S,6R)-6-but-3-enyl-1-methyl-4-prop-1-en-2-yl-5-prop-2-enyl-7-oxabicyclo[4.1.0]heptan-2-one.
| Compound Name | (1R,4R,5S,6R)-6-but-3-enyl-1-methyl-4-prop-1-en-2-yl-5-prop-2-enyl-7-oxabicyclo[4.1.0]heptan-2-one |
|---|---|
| PubChem CID | 101337614 |
| Molecular Formula | C17H24O2 |
| Molecular Weight | 260.38 g/mol |
| Exact Mass | 260.18 |
| IUPAC Name | (1R,4R,5S,6R)-6-but-3-enyl-1-methyl-4-prop-1-en-2-yl-5-prop-2-enyl-7-oxabicyclo[4.1.0]heptan-2-one |
| SMILES | C=CCC[C@]12O[C@@]1(C)C(=O)C[C@@H](C(=C)C)[C@@H]2CC=C |
| InChI | InChI=1S/C17H24O2/c1-6-8-10-17-14(9-7-2)13(12(3)4)11-15(18)16(17,5)19-17/h6-7,13-14H,1-3,8-11H2,4-5H3/t13-,14-,16-,17+/m0/s1 |
| InChIKey | FIFMJYHRSDZIGF-NXNVCVFFSA-N |
| XLogP | 3.84 |
| TPSA | 29.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.38 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|