C15H24O2Si — CID 135037844
(4R,5R)-4-acetyl-4-methyl-5-prop-2-enyl-2-trimethylsilylcyclohex-2-en-1-one (PubChem CID 135037844) has the molecular formula C15H24O2Si and a molecular weight of 264.44 g/mol. Its IUPAC name is (4R,5R)-4-acetyl-4-methyl-5-prop-2-enyl-2-trimethylsilylcyclohex-2-en-1-one.
| Compound Name | (4R,5R)-4-acetyl-4-methyl-5-prop-2-enyl-2-trimethylsilylcyclohex-2-en-1-one |
|---|---|
| PubChem CID | 135037844 |
| Molecular Formula | C15H24O2Si |
| Molecular Weight | 264.44 g/mol |
| Exact Mass | 264.15 |
| IUPAC Name | (4R,5R)-4-acetyl-4-methyl-5-prop-2-enyl-2-trimethylsilylcyclohex-2-en-1-one |
| SMILES | C=CC[C@@H]1CC(=O)C([Si](C)(C)C)=C[C@]1(C)C(C)=O |
| InChI | InChI=1S/C15H24O2Si/c1-7-8-12-9-13(17)14(18(4,5)6)10-15(12,3)11(2)16/h7,10,12H,1,8-9H2,2-6H3/t12-,15-/m1/s1 |
| InChIKey | ASHTWRFHPWGZNS-IUODEOHRSA-N |
| XLogP | 3.55 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.44 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|