C24H28O3 — CID 54509211
[4-[1-(4-methoxyphenyl)-2-prop-2-enylcyclohexyl]phenyl] acetate (PubChem CID 54509211) has the molecular formula C24H28O3 and a molecular weight of 364.49 g/mol. Its IUPAC name is [4-[1-(4-methoxyphenyl)-2-prop-2-enylcyclohexyl]phenyl] acetate.
| Compound Name | [4-[1-(4-methoxyphenyl)-2-prop-2-enylcyclohexyl]phenyl] acetate |
|---|---|
| PubChem CID | 54509211 |
| Molecular Formula | C24H28O3 |
| Molecular Weight | 364.49 g/mol |
| Exact Mass | 364.20 |
| IUPAC Name | [4-[1-(4-methoxyphenyl)-2-prop-2-enylcyclohexyl]phenyl] acetate |
| SMILES | C=CCC1CCCCC1(c1ccc(OC)cc1)c1ccc(OC(C)=O)cc1 |
| InChI | InChI=1S/C24H28O3/c1-4-7-19-8-5-6-17-24(19,20-9-13-22(26-3)14-10-20)21-11-15-23(16-12-21)27-18(2)25/h4,9-16,19H,1,5-8,17H2,2-3H3 |
| InChIKey | YHXPOUQHVDFQAS-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.49 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|