C27H28O3 — CID 23403218
[4-[5-(4-methoxyphenyl)-2,3-dimethyl-4-pentacyclo[4.4.0.02,5.03,8.04,7]decanyl]phenyl] acetate (PubChem CID 23403218) has the molecular formula C27H28O3 and a molecular weight of 400.52 g/mol. Its IUPAC name is [4-[5-(4-methoxyphenyl)-2,3-dimethyl-4-pentacyclo[4.4.0.02,5.03,8.04,7]decanyl]phenyl] acetate.
| Compound Name | [4-[5-(4-methoxyphenyl)-2,3-dimethyl-4-pentacyclo[4.4.0.02,5.03,8.04,7]decanyl]phenyl] acetate |
|---|---|
| PubChem CID | 23403218 |
| Molecular Formula | C27H28O3 |
| Molecular Weight | 400.52 g/mol |
| Exact Mass | 400.20 |
| IUPAC Name | [4-[5-(4-methoxyphenyl)-2,3-dimethyl-4-pentacyclo[4.4.0.02,5.03,8.04,7]decanyl]phenyl] acetate |
| SMILES | COc1ccc(C23C4C5CCC6C4C2(c2ccc(OC(C)=O)cc2)C6(C)C53C)cc1 |
| InChI | InChI=1S/C27H28O3/c1-15(28)30-19-11-7-17(8-12-19)27-23-21-14-13-20-22(23)26(27,24(20,2)25(21,27)3)16-5-9-18(29-4)10-6-16/h5-12,20-23H,13-14H2,1-4H3 |
| InChIKey | HUJHIAAJJXWWKV-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.52 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|