C25H32O3 — CID 22899840
[4-[1-(4-methoxyphenyl)-3,3,4,5-tetramethylcyclohexyl]phenyl] acetate (PubChem CID 22899840) has the molecular formula C25H32O3 and a molecular weight of 380.53 g/mol. Its IUPAC name is [4-[1-(4-methoxyphenyl)-3,3,4,5-tetramethylcyclohexyl]phenyl] acetate.
| Compound Name | [4-[1-(4-methoxyphenyl)-3,3,4,5-tetramethylcyclohexyl]phenyl] acetate |
|---|---|
| PubChem CID | 22899840 |
| Molecular Formula | C25H32O3 |
| Molecular Weight | 380.53 g/mol |
| Exact Mass | 380.24 |
| IUPAC Name | [4-[1-(4-methoxyphenyl)-3,3,4,5-tetramethylcyclohexyl]phenyl] acetate |
| SMILES | COc1ccc(C2(c3ccc(OC(C)=O)cc3)CC(C)C(C)C(C)(C)C2)cc1 |
| InChI | InChI=1S/C25H32O3/c1-17-15-25(16-24(4,5)18(17)2,20-7-11-22(27-6)12-8-20)21-9-13-23(14-10-21)28-19(3)26/h7-14,17-18H,15-16H2,1-6H3 |
| InChIKey | VFPPYIKRVRCISX-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.53 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|