C19H20O3 — CID 90310480
[4-[1-(4-methoxyphenyl)cyclobutyl]phenyl] acetate (PubChem CID 90310480) has the molecular formula C19H20O3 and a molecular weight of 296.37 g/mol. Its IUPAC name is [4-[1-(4-methoxyphenyl)cyclobutyl]phenyl] acetate.
| Compound Name | [4-[1-(4-methoxyphenyl)cyclobutyl]phenyl] acetate |
|---|---|
| PubChem CID | 90310480 |
| Molecular Formula | C19H20O3 |
| Molecular Weight | 296.37 g/mol |
| Exact Mass | 296.14 |
| IUPAC Name | [4-[1-(4-methoxyphenyl)cyclobutyl]phenyl] acetate |
| SMILES | COc1ccc(C2(c3ccc(OC(C)=O)cc3)CCC2)cc1 |
| InChI | InChI=1S/C19H20O3/c1-14(20)22-18-10-6-16(7-11-18)19(12-3-13-19)15-4-8-17(21-2)9-5-15/h4-11H,3,12-13H2,1-2H3 |
| InChIKey | FRAZMIWFXLWEBT-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.37 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|