C27H48O2Si2 — CID 138966126
3-[tert-butyl(dimethyl)silyl]-1-[(1R,5R)-2-[tert-butyl(dimethyl)silyl]oxy-1,4,4-trimethyl-5-prop-2-enylcyclohex-2-en-1-yl]prop-2-yn-1-one (PubChem CID 138966126) has the molecular formula C27H48O2Si2 and a molecular weight of 460.85 g/mol. Its IUPAC name is 3-[tert-butyl(dimethyl)silyl]-1-[(1R,5R)-2-[tert-butyl(dimethyl)silyl]oxy-1,4,4-trimethyl-5-prop-2-enylcyclohex-2-en-1-yl]prop-2-yn-1-one.
| Compound Name | 3-[tert-butyl(dimethyl)silyl]-1-[(1R,5R)-2-[tert-butyl(dimethyl)silyl]oxy-1,4,4-trimethyl-5-prop-2-enylcyclohex-2-en-1-yl]prop-2-yn-1-one |
|---|---|
| PubChem CID | 138966126 |
| Molecular Formula | C27H48O2Si2 |
| Molecular Weight | 460.85 g/mol |
| Exact Mass | 460.32 |
| IUPAC Name | 3-[tert-butyl(dimethyl)silyl]-1-[(1R,5R)-2-[tert-butyl(dimethyl)silyl]oxy-1,4,4-trimethyl-5-prop-2-enylcyclohex-2-en-1-yl]prop-2-yn-1-one |
| SMILES | C=CC[C@@H]1C[C@@](C)(C(=O)C#C[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)=CC1(C)C |
| InChI | InChI=1S/C27H48O2Si2/c1-15-16-21-19-27(10,22(28)17-18-30(11,12)24(2,3)4)23(20-26(21,8)9)29-31(13,14)25(5,6)7/h15,20-21H,1,16,19H2,2-14H3/t21-,27+/m1/s1 |
| InChIKey | MHYYXRNHOVLOLP-ZBLYBZFDSA-N |
| XLogP | 8.14 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.85 |
| LogP ≤ 5 | 8.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|