C19H33NO4Si — CID 101073438
methyl N-[(1S,6R)-3-[tert-butyl(dimethyl)silyl]oxy-6-formyl-6-methylcyclohex-2-en-1-yl]-N-prop-2-enylcarbamate (PubChem CID 101073438) has the molecular formula C19H33NO4Si and a molecular weight of 367.56 g/mol. Its IUPAC name is methyl N-[(1S,6R)-3-[tert-butyl(dimethyl)silyl]oxy-6-formyl-6-methylcyclohex-2-en-1-yl]-N-prop-2-enylcarbamate.
| Compound Name | methyl N-[(1S,6R)-3-[tert-butyl(dimethyl)silyl]oxy-6-formyl-6-methylcyclohex-2-en-1-yl]-N-prop-2-enylcarbamate |
|---|---|
| PubChem CID | 101073438 |
| Molecular Formula | C19H33NO4Si |
| Molecular Weight | 367.56 g/mol |
| Exact Mass | 367.22 |
| IUPAC Name | methyl N-[(1S,6R)-3-[tert-butyl(dimethyl)silyl]oxy-6-formyl-6-methylcyclohex-2-en-1-yl]-N-prop-2-enylcarbamate |
| SMILES | C=CCN(C(=O)OC)[C@H]1C=C(O[Si](C)(C)C(C)(C)C)CC[C@@]1(C)C=O |
| InChI | InChI=1S/C19H33NO4Si/c1-9-12-20(17(22)23-6)16-13-15(10-11-19(16,5)14-21)24-25(7,8)18(2,3)4/h9,13-14,16H,1,10-12H2,2-8H3/t16-,19-/m0/s1 |
| InChIKey | IEZSRTPROKDEOG-LPHOPBHVSA-N |
| XLogP | 4.51 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.56 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|