C28H43NO4Si2 — CID 44541526
methyl N-benzyl-N-[(1R,6R)-3-[tert-butyl(dimethyl)silyl]oxy-6-formyl-6-(3-trimethylsilylprop-2-ynyl)cyclohex-2-en-1-yl]carbamate (PubChem CID 44541526) has the molecular formula C28H43NO4Si2 and a molecular weight of 513.83 g/mol. Its IUPAC name is methyl N-benzyl-N-[(1R,6R)-3-[tert-butyl(dimethyl)silyl]oxy-6-formyl-6-(3-trimethylsilylprop-2-ynyl)cyclohex-2-en-1-yl]carbamate.
| Compound Name | methyl N-benzyl-N-[(1R,6R)-3-[tert-butyl(dimethyl)silyl]oxy-6-formyl-6-(3-trimethylsilylprop-2-ynyl)cyclohex-2-en-1-yl]carbamate |
|---|---|
| PubChem CID | 44541526 |
| Molecular Formula | C28H43NO4Si2 |
| Molecular Weight | 513.83 g/mol |
| Exact Mass | 513.27 |
| IUPAC Name | methyl N-benzyl-N-[(1R,6R)-3-[tert-butyl(dimethyl)silyl]oxy-6-formyl-6-(3-trimethylsilylprop-2-ynyl)cyclohex-2-en-1-yl]carbamate |
| SMILES | COC(=O)N(Cc1ccccc1)[C@@H]1C=C(O[Si](C)(C)C(C)(C)C)CC[C@@]1(C=O)CC#C[Si](C)(C)C |
| InChI | InChI=1S/C28H43NO4Si2/c1-27(2,3)35(8,9)33-24-16-18-28(22-30,17-13-19-34(5,6)7)25(20-24)29(26(31)32-4)21-23-14-11-10-12-15-23/h10-12,14-15,20,22,25H,16-18,21H2,1-9H3/t25-,28-/m1/s1 |
| InChIKey | INHXQJVMXVMCHE-LEAFIULHSA-N |
| XLogP | 6.78 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.83 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|