C21H35NO4Si — CID 102054393
methyl N-[(3aR,4S,7aS)-6-[tert-butyl(dimethyl)silyl]oxy-3a-formyl-1,2,3,4,7,7a-hexahydroinden-4-yl]-N-prop-2-enylcarbamate (PubChem CID 102054393) has the molecular formula C21H35NO4Si and a molecular weight of 393.60 g/mol. Its IUPAC name is methyl N-[(3aR,4S,7aS)-6-[tert-butyl(dimethyl)silyl]oxy-3a-formyl-1,2,3,4,7,7a-hexahydroinden-4-yl]-N-prop-2-enylcarbamate.
| Compound Name | methyl N-[(3aR,4S,7aS)-6-[tert-butyl(dimethyl)silyl]oxy-3a-formyl-1,2,3,4,7,7a-hexahydroinden-4-yl]-N-prop-2-enylcarbamate |
|---|---|
| PubChem CID | 102054393 |
| Molecular Formula | C21H35NO4Si |
| Molecular Weight | 393.60 g/mol |
| Exact Mass | 393.23 |
| IUPAC Name | methyl N-[(3aR,4S,7aS)-6-[tert-butyl(dimethyl)silyl]oxy-3a-formyl-1,2,3,4,7,7a-hexahydroinden-4-yl]-N-prop-2-enylcarbamate |
| SMILES | C=CCN(C(=O)OC)[C@H]1C=C(O[Si](C)(C)C(C)(C)C)C[C@@H]2CCC[C@@]21C=O |
| InChI | InChI=1S/C21H35NO4Si/c1-8-12-22(19(24)25-5)18-14-17(26-27(6,7)20(2,3)4)13-16-10-9-11-21(16,18)15-23/h8,14-16,18H,1,9-13H2,2-7H3/t16-,18-,21+/m0/s1 |
| InChIKey | JSJKYWNKUKKWOS-DJPFJPOOSA-N |
| XLogP | 4.90 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.60 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|