C15H27NO3Si — CID 11120045
methyl N-[(1E)-3-[tert-butyl(dimethyl)silyl]oxybuta-1,3-dienyl]-N-prop-2-enylcarbamate (PubChem CID 11120045) has the molecular formula C15H27NO3Si and a molecular weight of 297.47 g/mol. Its IUPAC name is methyl N-[(1E)-3-[tert-butyl(dimethyl)silyl]oxybuta-1,3-dienyl]-N-prop-2-enylcarbamate.
| Compound Name | methyl N-[(1E)-3-[tert-butyl(dimethyl)silyl]oxybuta-1,3-dienyl]-N-prop-2-enylcarbamate |
|---|---|
| PubChem CID | 11120045 |
| Molecular Formula | C15H27NO3Si |
| Molecular Weight | 297.47 g/mol |
| Exact Mass | 297.18 |
| IUPAC Name | methyl N-[(1E)-3-[tert-butyl(dimethyl)silyl]oxybuta-1,3-dienyl]-N-prop-2-enylcarbamate |
| SMILES | C=CCN(/C=C/C(=C)O[Si](C)(C)C(C)(C)C)C(=O)OC |
| InChI | InChI=1S/C15H27NO3Si/c1-9-11-16(14(17)18-6)12-10-13(2)19-20(7,8)15(3,4)5/h9-10,12H,1-2,11H2,3-8H3/b12-10+ |
| InChIKey | HCMXNSSAJRVNFN-ZRDIBKRKSA-N |
| XLogP | 4.29 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.47 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|