C14H26O2Si — CID 155930352
tert-butyl-[(1Z,3Z)-1-methoxyhepta-1,3,6-trienoxy]-dimethylsilane (PubChem CID 155930352) has the molecular formula C14H26O2Si and a molecular weight of 254.45 g/mol. Its IUPAC name is tert-butyl-[(1Z,3Z)-1-methoxyhepta-1,3,6-trienoxy]-dimethylsilane.
| Compound Name | tert-butyl-[(1Z,3Z)-1-methoxyhepta-1,3,6-trienoxy]-dimethylsilane |
|---|---|
| PubChem CID | 155930352 |
| Molecular Formula | C14H26O2Si |
| Molecular Weight | 254.45 g/mol |
| Exact Mass | 254.17 |
| IUPAC Name | tert-butyl-[(1Z,3Z)-1-methoxyhepta-1,3,6-trienoxy]-dimethylsilane |
| SMILES | C=CC/C=C\C=C(\OC)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C14H26O2Si/c1-8-9-10-11-12-13(15-5)16-17(6,7)14(2,3)4/h8,10-12H,1,9H2,2-7H3/b11-10-,13-12- |
| InChIKey | UKTYYXPUWZZDLL-FQEMRORKSA-N |
| XLogP | 4.63 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.45 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|