C22H32O2Si — CID 132594355
2-[2-[tert-butyl(dimethyl)silyl]oxy-3-prop-2-enylcyclopent-2-en-1-yl]-1-phenylethanone (PubChem CID 132594355) has the molecular formula C22H32O2Si and a molecular weight of 356.58 g/mol. Its IUPAC name is 2-[2-[tert-butyl(dimethyl)silyl]oxy-3-prop-2-enylcyclopent-2-en-1-yl]-1-phenylethanone.
| Compound Name | 2-[2-[tert-butyl(dimethyl)silyl]oxy-3-prop-2-enylcyclopent-2-en-1-yl]-1-phenylethanone |
|---|---|
| PubChem CID | 132594355 |
| Molecular Formula | C22H32O2Si |
| Molecular Weight | 356.58 g/mol |
| Exact Mass | 356.22 |
| IUPAC Name | 2-[2-[tert-butyl(dimethyl)silyl]oxy-3-prop-2-enylcyclopent-2-en-1-yl]-1-phenylethanone |
| SMILES | C=CCC1=C(O[Si](C)(C)C(C)(C)C)C(CC(=O)c2ccccc2)CC1 |
| InChI | InChI=1S/C22H32O2Si/c1-7-11-18-14-15-19(16-20(23)17-12-9-8-10-13-17)21(18)24-25(5,6)22(2,3)4/h7-10,12-13,19H,1,11,14-16H2,2-6H3 |
| InChIKey | WZTCVZANWVUGCM-UHFFFAOYSA-N |
| XLogP | 6.52 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.58 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|