C20H30O3Si — CID 132570844
methyl (2E)-4-[tert-butyl(dimethyl)silyl]oxy-4-methyl-2-phenylhexa-2,5-dienoate (PubChem CID 132570844) has the molecular formula C20H30O3Si and a molecular weight of 346.54 g/mol. Its IUPAC name is methyl (2E)-4-[tert-butyl(dimethyl)silyl]oxy-4-methyl-2-phenylhexa-2,5-dienoate.
| Compound Name | methyl (2E)-4-[tert-butyl(dimethyl)silyl]oxy-4-methyl-2-phenylhexa-2,5-dienoate |
|---|---|
| PubChem CID | 132570844 |
| Molecular Formula | C20H30O3Si |
| Molecular Weight | 346.54 g/mol |
| Exact Mass | 346.20 |
| IUPAC Name | methyl (2E)-4-[tert-butyl(dimethyl)silyl]oxy-4-methyl-2-phenylhexa-2,5-dienoate |
| SMILES | C=CC(C)(/C=C(/C(=O)OC)c1ccccc1)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C20H30O3Si/c1-9-20(5,23-24(7,8)19(2,3)4)15-17(18(21)22-6)16-13-11-10-12-14-16/h9-15H,1H2,2-8H3/b17-15+ |
| InChIKey | SNRWTSGVGUCGJN-BMRADRMJSA-N |
| XLogP | 5.21 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.54 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|