C32H51O3PSSi2 — CID 158889670
CID 158889670 (PubChem CID 158889670) has the molecular formula C32H51O3PSSi2 and a molecular weight of 604.98 g/mol.
| Compound Name | CID 158889670 |
|---|---|
| PubChem CID | 158889670 |
| Molecular Formula | C32H51O3PSSi2 |
| Molecular Weight | 604.98 g/mol |
| Exact Mass | 604.29 |
| IUPAC Name | — |
| SMILES | C=CCc1ccccc1O[Si](C)(C)C(C)(C)C.CC(=O)/C=C/Cc1ccccc1O[Si](C)(C)C(C)(C)C.[3H]P=S |
| InChI | InChI=1S/C17H26O2Si.C15H24OSi.HPS/c1-14(18)10-9-12-15-11-7-8-13-16(15)19-20(5,6)17(2,3)4;1-7-10-13-11-8-9-12-14(13)16-17(5,6)15(2,3)4;1-2/h7-11,13H,12H2,1-6H3;7-9,11-12H,1,10H2,2-6H3;1H/b10-9+;;/i;;1T |
| InChIKey | JEBMDUQRRYEGFW-GZJZZYABSA-N |
| XLogP | 10.15 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.98 |
| LogP ≤ 5 | 10.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|