C34H42O3Si — CID 72543849
tert-butyl-dimethyl-[[(2S)-5-prop-2-enyl-2-(trityloxymethyl)-3,6-dihydro-2H-pyran-4-yl]oxy]silane (PubChem CID 72543849) has the molecular formula C34H42O3Si and a molecular weight of 526.79 g/mol. Its IUPAC name is tert-butyl-dimethyl-[[(2S)-5-prop-2-enyl-2-(trityloxymethyl)-3,6-dihydro-2H-pyran-4-yl]oxy]silane.
| Compound Name | tert-butyl-dimethyl-[[(2S)-5-prop-2-enyl-2-(trityloxymethyl)-3,6-dihydro-2H-pyran-4-yl]oxy]silane |
|---|---|
| PubChem CID | 72543849 |
| Molecular Formula | C34H42O3Si |
| Molecular Weight | 526.79 g/mol |
| Exact Mass | 526.29 |
| IUPAC Name | tert-butyl-dimethyl-[[(2S)-5-prop-2-enyl-2-(trityloxymethyl)-3,6-dihydro-2H-pyran-4-yl]oxy]silane |
| SMILES | C=CCC1=C(O[Si](C)(C)C(C)(C)C)C[C@@H](COC(c2ccccc2)(c2ccccc2)c2ccccc2)OC1 |
| InChI | InChI=1S/C34H42O3Si/c1-7-17-27-25-35-31(24-32(27)37-38(5,6)33(2,3)4)26-36-34(28-18-11-8-12-19-28,29-20-13-9-14-21-29)30-22-15-10-16-23-30/h7-16,18-23,31H,1,17,24-26H2,2-6H3/t31-/m0/s1 |
| InChIKey | SEEFSMIADQDWAX-HKBQPEDESA-N |
| XLogP | 8.64 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.79 |
| LogP ≤ 5 | 8.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|