C34H52N2O5 — CID 101337988
5-octoxy-2-[2-[2-[(4-octoxy-7-oxocyclohepta-1,3,5-trien-1-yl)amino]ethoxy]ethylamino]cyclohepta-2,4,6-trien-1-one (PubChem CID 101337988) has the molecular formula C34H52N2O5 and a molecular weight of 568.80 g/mol. Its IUPAC name is 5-octoxy-2-[2-[2-[(4-octoxy-7-oxocyclohepta-1,3,5-trien-1-yl)amino]ethoxy]ethylamino]cyclohepta-2,4,6-trien-1-one.
| Compound Name | 5-octoxy-2-[2-[2-[(4-octoxy-7-oxocyclohepta-1,3,5-trien-1-yl)amino]ethoxy]ethylamino]cyclohepta-2,4,6-trien-1-one |
|---|---|
| PubChem CID | 101337988 |
| Molecular Formula | C34H52N2O5 |
| Molecular Weight | 568.80 g/mol |
| Exact Mass | 568.39 |
| IUPAC Name | 5-octoxy-2-[2-[2-[(4-octoxy-7-oxocyclohepta-1,3,5-trien-1-yl)amino]ethoxy]ethylamino]cyclohepta-2,4,6-trien-1-one |
| SMILES | CCCCCCCCOc1ccc(NCCOCCNc2ccc(OCCCCCCCC)ccc2=O)c(=O)cc1 |
| InChI | InChI=1S/C34H52N2O5/c1-3-5-7-9-11-13-25-40-29-15-19-31(33(37)21-17-29)35-23-27-39-28-24-36-32-20-16-30(18-22-34(32)38)41-26-14-12-10-8-6-4-2/h15-22H,3-14,23-28H2,1-2H3,(H,35,37)(H,36,38) |
| InChIKey | LURKIEPELJWGPJ-UHFFFAOYSA-N |
| XLogP | 7.43 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.80 |
| LogP ≤ 5 | 7.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|