About bis(3-methyl-5-oxopyrazolidine-4-carbonyl) benzene-1,2-dicarboxylate
bis(3-methyl-5-oxopyrazolidine-4-carbonyl) benzene-1,2-dicarboxylate (PubChem CID 101338955) has the molecular formula C18H18N4O8
and a molecular weight of 418.36 g/mol. Its IUPAC name is bis(3-methyl-5-oxopyrazolidine-4-carbonyl) benzene-1,2-dicarboxylate.
Molecular Properties
| Compound Name | bis(3-methyl-5-oxopyrazolidine-4-carbonyl) benzene-1,2-dicarboxylate |
| PubChem CID | 101338955 |
| Molecular Formula | C18H18N4O8 |
| Molecular Weight | 418.36 g/mol |
| Exact Mass | 418.11 |
| IUPAC Name | bis(3-methyl-5-oxopyrazolidine-4-carbonyl) benzene-1,2-dicarboxylate |
| SMILES | CC1NNC(=O)C1C(=O)OC(=O)c1ccccc1C(=O)OC(=O)C1C(=O)NNC1C |
| InChI | InChI=1S/C18H18N4O8/c1-7-11(13(23)21-19-7)17(27)29-15(25)9-5-3-4-6-10(9)16(26)30-18(28)12-8(2)20-22-14(12)24/h3-8,11-12,19-20H,1-2H3,(H,21,23)(H,22,24) |
| InChIKey | GEMHYRHKAYJLGZ-UHFFFAOYSA-N |
| XLogP | -1.67 |
| TPSA | 169.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 418.36 |
| LogP ≤ 5 | -1.67 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze bis(3-methyl-5-oxopyrazolidine-4-carbonyl) benzene-1,2-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(3-methyl-5-oxopyrazolidine-4-carbonyl) benzene-1,2-dicarboxylate?
The IUPAC name of bis(3-methyl-5-oxopyrazolidine-4-carbonyl) benzene-1,2-dicarboxylate (CID 101338955) is bis(3-methyl-5-oxopyrazolidine-4-carbonyl) benzene-1,2-dicarboxylate.
What is the SMILES notation for bis(3-methyl-5-oxopyrazolidine-4-carbonyl) benzene-1,2-dicarboxylate?
The canonical SMILES for bis(3-methyl-5-oxopyrazolidine-4-carbonyl) benzene-1,2-dicarboxylate is CC1NNC(=O)C1C(=O)OC(=O)c1ccccc1C(=O)OC(=O)C1C(=O)NNC1C.
What is the InChIKey of bis(3-methyl-5-oxopyrazolidine-4-carbonyl) benzene-1,2-dicarboxylate?
The InChIKey is GEMHYRHKAYJLGZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H18N4O8/c1-7-11(13(23)21-19-7)17(27)29-15(25)9-5-3-4-6-10(9)16(26)30-18(28)12-8(2)20-22-14(12)24/h3-8,11-12,19-20H,1-2H3,(H,21,23)(H,22,24).
What are the key properties of bis(3-methyl-5-oxopyrazolidine-4-carbonyl) benzene-1,2-dicarboxylate?
bis(3-methyl-5-oxopyrazolidine-4-carbonyl) benzene-1,2-dicarboxylate has a molecular weight of 418.36 g/mol, XLogP of -1.67, 4 rotatable bonds, 4 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for bis(3-methyl-5-oxopyrazolidine-4-carbonyl) benzene-1,2-dicarboxylate is sourced from PubChem (CID 101338955), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).