C18H18N4O8 — CID 101338955
bis(3-methyl-5-oxopyrazolidine-4-carbonyl) benzene-1,2-dicarboxylate (PubChem CID 101338955) has the molecular formula C18H18N4O8 and a molecular weight of 418.36 g/mol. Its IUPAC name is bis(3-methyl-5-oxopyrazolidine-4-carbonyl) benzene-1,2-dicarboxylate.
| Compound Name | bis(3-methyl-5-oxopyrazolidine-4-carbonyl) benzene-1,2-dicarboxylate |
|---|---|
| PubChem CID | 101338955 |
| Molecular Formula | C18H18N4O8 |
| Molecular Weight | 418.36 g/mol |
| Exact Mass | 418.11 |
| IUPAC Name | bis(3-methyl-5-oxopyrazolidine-4-carbonyl) benzene-1,2-dicarboxylate |
| SMILES | CC1NNC(=O)C1C(=O)OC(=O)c1ccccc1C(=O)OC(=O)C1C(=O)NNC1C |
| InChI | InChI=1S/C18H18N4O8/c1-7-11(13(23)21-19-7)17(27)29-15(25)9-5-3-4-6-10(9)16(26)30-18(28)12-8(2)20-22-14(12)24/h3-8,11-12,19-20H,1-2H3,(H,21,23)(H,22,24) |
| InChIKey | GEMHYRHKAYJLGZ-UHFFFAOYSA-N |
| XLogP | -1.67 |
| TPSA | 169.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.36 |
| LogP ≤ 5 | -1.67 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|