C14H16O6 — CID 101340489
methyl (1R,4R,5S,8R)-4-[(E)-4-methoxy-4-oxobut-2-en-2-yl]-7-oxo-6-oxabicyclo[3.2.1]oct-2-ene-8-carboxylate (PubChem CID 101340489) has the molecular formula C14H16O6 and a molecular weight of 280.28 g/mol. Its IUPAC name is methyl (1R,4R,5S,8R)-4-[(E)-4-methoxy-4-oxobut-2-en-2-yl]-7-oxo-6-oxabicyclo[3.2.1]oct-2-ene-8-carboxylate.
| Compound Name | methyl (1R,4R,5S,8R)-4-[(E)-4-methoxy-4-oxobut-2-en-2-yl]-7-oxo-6-oxabicyclo[3.2.1]oct-2-ene-8-carboxylate |
|---|---|
| PubChem CID | 101340489 |
| Molecular Formula | C14H16O6 |
| Molecular Weight | 280.28 g/mol |
| Exact Mass | 280.09 |
| IUPAC Name | methyl (1R,4R,5S,8R)-4-[(E)-4-methoxy-4-oxobut-2-en-2-yl]-7-oxo-6-oxabicyclo[3.2.1]oct-2-ene-8-carboxylate |
| SMILES | COC(=O)/C=C(\C)[C@H]1C=C[C@H]2C(=O)O[C@@H]1[C@@H]2C(=O)OC |
| InChI | InChI=1S/C14H16O6/c1-7(6-10(15)18-2)8-4-5-9-11(14(17)19-3)12(8)20-13(9)16/h4-6,8-9,11-12H,1-3H3/b7-6+/t8-,9-,11-,12+/m1/s1 |
| InChIKey | HOWULHZKXUTFFO-NLMDMLHGSA-N |
| XLogP | 0.62 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.28 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|