About 3-{4-[4-(4-Fluoro-phenyl)-piperazin-1-yl]-butyl}-1H-indole-5-carbonitrile
3-{4-[4-(4-Fluoro-phenyl)-piperazin-1-yl]-butyl}-1H-indole-5-carbonitrile (PubChem CID 10134144) has the molecular formula C23H25FN4
and a molecular weight of 376.50 g/mol. Its IUPAC name is 3-[4-[4-(4-fluorophenyl)piperazin-1-yl]butyl]-1H-indole-5-carbonitrile.
Molecular Properties
| Compound Name | 3-{4-[4-(4-Fluoro-phenyl)-piperazin-1-yl]-butyl}-1H-indole-5-carbonitrile |
| PubChem CID | 10134144 |
| Molecular Formula | C23H25FN4 |
| Molecular Weight | 376.50 g/mol |
| Exact Mass | 376.21 |
| IUPAC Name | 3-[4-[4-(4-fluorophenyl)piperazin-1-yl]butyl]-1H-indole-5-carbonitrile |
| SMILES | C1CN(CCN1CCCCC2=CNC3=C2C=C(C=C3)C#N)C4=CC=C(C=C4)F |
| InChI | InChI=1S/C23H25FN4/c24-20-5-7-21(8-6-20)28-13-11-27(12-14-28)10-2-1-3-19-17-26-23-9-4-18(16-25)15-22(19)23/h4-9,15,17,26H,1-3,10-14H2 |
| InChIKey | FAKUMASWBXILCF-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 46.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | 530 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 376.50 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-{4-[4-(4-Fluoro-phenyl)-piperazin-1-yl]-butyl}-1H-indole-5-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-{4-[4-(4-Fluoro-phenyl)-piperazin-1-yl]-butyl}-1H-indole-5-carbonitrile?
The IUPAC name of 3-{4-[4-(4-Fluoro-phenyl)-piperazin-1-yl]-butyl}-1H-indole-5-carbonitrile (CID 10134144) is 3-[4-[4-(4-fluorophenyl)piperazin-1-yl]butyl]-1H-indole-5-carbonitrile.
What is the SMILES notation for 3-{4-[4-(4-Fluoro-phenyl)-piperazin-1-yl]-butyl}-1H-indole-5-carbonitrile?
The canonical SMILES for 3-{4-[4-(4-Fluoro-phenyl)-piperazin-1-yl]-butyl}-1H-indole-5-carbonitrile is C1CN(CCN1CCCCC2=CNC3=C2C=C(C=C3)C#N)C4=CC=C(C=C4)F.
What is the InChIKey of 3-{4-[4-(4-Fluoro-phenyl)-piperazin-1-yl]-butyl}-1H-indole-5-carbonitrile?
The InChIKey is FAKUMASWBXILCF-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H25FN4/c24-20-5-7-21(8-6-20)28-13-11-27(12-14-28)10-2-1-3-19-17-26-23-9-4-18(16-25)15-22(19)23/h4-9,15,17,26H,1-3,10-14H2.
What are the key properties of 3-{4-[4-(4-Fluoro-phenyl)-piperazin-1-yl]-butyl}-1H-indole-5-carbonitrile?
3-{4-[4-(4-Fluoro-phenyl)-piperazin-1-yl]-butyl}-1H-indole-5-carbonitrile has a molecular weight of 376.50 g/mol, XLogP of 4.50, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-{4-[4-(4-Fluoro-phenyl)-piperazin-1-yl]-butyl}-1H-indole-5-carbonitrile is sourced from PubChem (CID 10134144), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).