C24H26FNO2 — CID 10134328
2-[[(Z)-5-(4-tert-butylphenyl)-3-(2-fluorophenyl)pent-2-en-4-ynyl]-methylamino]acetic acid (PubChem CID 10134328) has the molecular formula C24H26FNO2 and a molecular weight of 379.48 g/mol. Its IUPAC name is 2-[[(Z)-5-(4-tert-butylphenyl)-3-(2-fluorophenyl)pent-2-en-4-ynyl]-methylamino]acetic acid.
| Compound Name | 2-[[(Z)-5-(4-tert-butylphenyl)-3-(2-fluorophenyl)pent-2-en-4-ynyl]-methylamino]acetic acid |
|---|---|
| PubChem CID | 10134328 |
| Molecular Formula | C24H26FNO2 |
| Molecular Weight | 379.48 g/mol |
| Exact Mass | 379.19 |
| IUPAC Name | 2-[[(Z)-5-(4-tert-butylphenyl)-3-(2-fluorophenyl)pent-2-en-4-ynyl]-methylamino]acetic acid |
| SMILES | CN(C/C=C(/C#Cc1ccc(C(C)(C)C)cc1)c1ccccc1F)CC(=O)O |
| InChI | InChI=1S/C24H26FNO2/c1-24(2,3)20-13-10-18(11-14-20)9-12-19(15-16-26(4)17-23(27)28)21-7-5-6-8-22(21)25/h5-8,10-11,13-15H,16-17H2,1-4H3,(H,27,28)/b19-15- |
| InChIKey | DHCFJRYMDHOIPV-CYVLTUHYSA-N |
| XLogP | 4.57 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.48 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|