C24H22F3NO2 — CID 21019864
2-[methyl-[3,3,3-tris(4-fluorophenyl)propyl]amino]acetic acid (PubChem CID 21019864) has the molecular formula C24H22F3NO2 and a molecular weight of 413.44 g/mol. Its IUPAC name is 2-[methyl-[3,3,3-tris(4-fluorophenyl)propyl]amino]acetic acid.
| Compound Name | 2-[methyl-[3,3,3-tris(4-fluorophenyl)propyl]amino]acetic acid |
|---|---|
| PubChem CID | 21019864 |
| Molecular Formula | C24H22F3NO2 |
| Molecular Weight | 413.44 g/mol |
| Exact Mass | 413.16 |
| IUPAC Name | 2-[methyl-[3,3,3-tris(4-fluorophenyl)propyl]amino]acetic acid |
| SMILES | CN(CCC(c1ccc(F)cc1)(c1ccc(F)cc1)c1ccc(F)cc1)CC(=O)O |
| InChI | InChI=1S/C24H22F3NO2/c1-28(16-23(29)30)15-14-24(17-2-8-20(25)9-3-17,18-4-10-21(26)11-5-18)19-6-12-22(27)13-7-19/h2-13H,14-16H2,1H3,(H,29,30) |
| InChIKey | IBGSCZUAKBXBNT-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.44 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|