C25H33N3O3 — CID 101348237
tert-butyl N-[(2S)-1-[2-(5-methoxy-1H-indol-2-yl)ethylamino]-3-phenylpropan-2-yl]carbamate (PubChem CID 101348237) has the molecular formula C25H33N3O3 and a molecular weight of 423.56 g/mol. Its IUPAC name is tert-butyl N-[(2S)-1-[2-(5-methoxy-1H-indol-2-yl)ethylamino]-3-phenylpropan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S)-1-[2-(5-methoxy-1H-indol-2-yl)ethylamino]-3-phenylpropan-2-yl]carbamate |
|---|---|
| PubChem CID | 101348237 |
| Molecular Formula | C25H33N3O3 |
| Molecular Weight | 423.56 g/mol |
| Exact Mass | 423.25 |
| IUPAC Name | tert-butyl N-[(2S)-1-[2-(5-methoxy-1H-indol-2-yl)ethylamino]-3-phenylpropan-2-yl]carbamate |
| SMILES | COc1ccc2[nH]c(CCNC[C@H](Cc3ccccc3)NC(=O)OC(C)(C)C)cc2c1 |
| InChI | InChI=1S/C25H33N3O3/c1-25(2,3)31-24(29)28-21(14-18-8-6-5-7-9-18)17-26-13-12-20-15-19-16-22(30-4)10-11-23(19)27-20/h5-11,15-16,21,26-27H,12-14,17H2,1-4H3,(H,28,29)/t21-/m0/s1 |
| InChIKey | OEIFPMUYSJHEII-NRFANRHFSA-N |
| XLogP | 4.44 |
| TPSA | 75.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.56 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|