C13H21NSi — CID 101350393
(E)-3-[dimethyl(phenyl)silyl]-N,N-dimethylprop-2-en-1-amine (PubChem CID 101350393) has the molecular formula C13H21NSi and a molecular weight of 219.40 g/mol. Its IUPAC name is (E)-3-[dimethyl(phenyl)silyl]-N,N-dimethylprop-2-en-1-amine.
| Compound Name | (E)-3-[dimethyl(phenyl)silyl]-N,N-dimethylprop-2-en-1-amine |
|---|---|
| PubChem CID | 101350393 |
| Molecular Formula | C13H21NSi |
| Molecular Weight | 219.40 g/mol |
| Exact Mass | 219.14 |
| IUPAC Name | (E)-3-[dimethyl(phenyl)silyl]-N,N-dimethylprop-2-en-1-amine |
| SMILES | CN(C)C/C=C/[Si](C)(C)c1ccccc1 |
| InChI | InChI=1S/C13H21NSi/c1-14(2)11-8-12-15(3,4)13-9-6-5-7-10-13/h5-10,12H,11H2,1-4H3/b12-8+ |
| InChIKey | USMZCFMLFXHVMR-XYOKQWHBSA-N |
| XLogP | 2.26 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.40 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|