C11H16F3NO2 — CID 101350603
tert-butyl 2-[(E)-3,3,3-trifluoroprop-1-enyl]azetidine-1-carboxylate (PubChem CID 101350603) has the molecular formula C11H16F3NO2 and a molecular weight of 251.25 g/mol. Its IUPAC name is tert-butyl 2-[(E)-3,3,3-trifluoroprop-1-enyl]azetidine-1-carboxylate.
| Compound Name | tert-butyl 2-[(E)-3,3,3-trifluoroprop-1-enyl]azetidine-1-carboxylate |
|---|---|
| PubChem CID | 101350603 |
| Molecular Formula | C11H16F3NO2 |
| Molecular Weight | 251.25 g/mol |
| Exact Mass | 251.11 |
| IUPAC Name | tert-butyl 2-[(E)-3,3,3-trifluoroprop-1-enyl]azetidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC1/C=C/C(F)(F)F |
| InChI | InChI=1S/C11H16F3NO2/c1-10(2,3)17-9(16)15-7-5-8(15)4-6-11(12,13)14/h4,6,8H,5,7H2,1-3H3/b6-4+ |
| InChIKey | QWONASUMGBDWMP-GQCTYLIASA-N |
| XLogP | 3.11 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.25 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|