C32H43NO11Si — CID 101350656
methyl (2S,4S,5R,6R)-5-acetamido-4-acetyloxy-6-[(1R,2R)-1-acetyloxy-3-[tert-butyl(diphenyl)silyl]oxy-2-hydroxypropyl]-2-hydroxyoxane-2-carboxylate (PubChem CID 101350656) has the molecular formula C32H43NO11Si and a molecular weight of 645.78 g/mol. Its IUPAC name is methyl (2S,4S,5R,6R)-5-acetamido-4-acetyloxy-6-[(1R,2R)-1-acetyloxy-3-[tert-butyl(diphenyl)silyl]oxy-2-hydroxypropyl]-2-hydroxyoxane-2-carboxylate.
| Compound Name | methyl (2S,4S,5R,6R)-5-acetamido-4-acetyloxy-6-[(1R,2R)-1-acetyloxy-3-[tert-butyl(diphenyl)silyl]oxy-2-hydroxypropyl]-2-hydroxyoxane-2-carboxylate |
|---|---|
| PubChem CID | 101350656 |
| Molecular Formula | C32H43NO11Si |
| Molecular Weight | 645.78 g/mol |
| Exact Mass | 645.26 |
| IUPAC Name | methyl (2S,4S,5R,6R)-5-acetamido-4-acetyloxy-6-[(1R,2R)-1-acetyloxy-3-[tert-butyl(diphenyl)silyl]oxy-2-hydroxypropyl]-2-hydroxyoxane-2-carboxylate |
| SMILES | COC(=O)[C@]1(O)C[C@H](OC(C)=O)[C@@H](NC(C)=O)[C@H]([C@H](OC(C)=O)[C@H](O)CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)O1 |
| InChI | InChI=1S/C32H43NO11Si/c1-20(34)33-27-26(42-21(2)35)18-32(39,30(38)40-7)44-29(27)28(43-22(3)36)25(37)19-41-45(31(4,5)6,23-14-10-8-11-15-23)24-16-12-9-13-17-24/h8-17,25-29,37,39H,18-19H2,1-7H3,(H,33,34)/t25-,26+,27-,28-,29-,32+/m1/s1 |
| InChIKey | LHHODAXHGJJSMC-LXWHGCMFSA-N |
| XLogP | 0.94 |
| TPSA | 166.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.78 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|