C22H24N3O2 — CID 101350938
CID 101350938 (PubChem CID 101350938) has the molecular formula C22H24N3O2 and a molecular weight of 362.45 g/mol.
| Compound Name | CID 101350938 |
|---|---|
| PubChem CID | 101350938 |
| Molecular Formula | C22H24N3O2 |
| Molecular Weight | 362.45 g/mol |
| Exact Mass | 362.19 |
| IUPAC Name | — |
| SMILES | CC1(C)CCC(C)(c2ccc(Cc3n[nH]c(=O)c4ccccc34)cc2)N1[O] |
| InChI | InChI=1S/C22H24N3O2/c1-21(2)12-13-22(3,25(21)27)16-10-8-15(9-11-16)14-19-17-6-4-5-7-18(17)20(26)24-23-19/h4-11H,12-14H2,1-3H3,(H,24,26) |
| InChIKey | UMQNDVILFSTPCG-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 68.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.45 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |