About CID 101350938
CID 101350938 (PubChem CID 101350938) has the molecular formula C22H24N3O2
and a molecular weight of 362.45 g/mol.
Molecular Properties
| Compound Name | CID 101350938 |
| PubChem CID | 101350938 |
| Molecular Formula | C22H24N3O2 |
| Molecular Weight | 362.45 g/mol |
| Exact Mass | 362.19 |
| IUPAC Name | — |
| SMILES | CC1(C)CCC(C)(c2ccc(Cc3n[nH]c(=O)c4ccccc34)cc2)N1[O] |
| InChI | InChI=1S/C22H24N3O2/c1-21(2)12-13-22(3,25(21)27)16-10-8-15(9-11-16)14-19-17-6-4-5-7-18(17)20(26)24-23-19/h4-11H,12-14H2,1-3H3,(H,24,26) |
| InChIKey | UMQNDVILFSTPCG-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 68.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 362.45 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze CID 101350938 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 101350938?
The IUPAC name of CID 101350938 (CID 101350938) is not available.
What is the SMILES notation for CID 101350938?
The canonical SMILES for CID 101350938 is CC1(C)CCC(C)(c2ccc(Cc3n[nH]c(=O)c4ccccc34)cc2)N1[O].
What is the InChIKey of CID 101350938?
The InChIKey is UMQNDVILFSTPCG-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H24N3O2/c1-21(2)12-13-22(3,25(21)27)16-10-8-15(9-11-16)14-19-17-6-4-5-7-18(17)20(26)24-23-19/h4-11H,12-14H2,1-3H3,(H,24,26).
What are the key properties of CID 101350938?
CID 101350938 has a molecular weight of 362.45 g/mol, XLogP of 3.95, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 101350938 is sourced from PubChem (CID 101350938), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).