C19H15N3O3 — CID 91219912
4-[[3-(2,5-dihydroxypyrrol-1-yl)phenyl]methyl]-2H-phthalazin-1-one (PubChem CID 91219912) has the molecular formula C19H15N3O3 and a molecular weight of 333.35 g/mol. Its IUPAC name is 4-[[3-(2,5-dihydroxypyrrol-1-yl)phenyl]methyl]-2H-phthalazin-1-one.
| Compound Name | 4-[[3-(2,5-dihydroxypyrrol-1-yl)phenyl]methyl]-2H-phthalazin-1-one |
|---|---|
| PubChem CID | 91219912 |
| Molecular Formula | C19H15N3O3 |
| Molecular Weight | 333.35 g/mol |
| Exact Mass | 333.11 |
| IUPAC Name | 4-[[3-(2,5-dihydroxypyrrol-1-yl)phenyl]methyl]-2H-phthalazin-1-one |
| SMILES | O=c1[nH]nc(Cc2cccc(-n3c(O)ccc3O)c2)c2ccccc12 |
| InChI | InChI=1S/C19H15N3O3/c23-17-8-9-18(24)22(17)13-5-3-4-12(10-13)11-16-14-6-1-2-7-15(14)19(25)21-20-16/h1-10,23-24H,11H2,(H,21,25) |
| InChIKey | MKHLHBYKZULRCX-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 91.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.35 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |