C21H22N4O2 — CID 25132256
4-[[3-(1,4-diazepane-1-carbonyl)phenyl]methyl]-2H-phthalazin-1-one (PubChem CID 25132256) has the molecular formula C21H22N4O2 and a molecular weight of 362.43 g/mol. Its IUPAC name is 4-[[3-(1,4-diazepane-1-carbonyl)phenyl]methyl]-2H-phthalazin-1-one.
| Compound Name | 4-[[3-(1,4-diazepane-1-carbonyl)phenyl]methyl]-2H-phthalazin-1-one |
|---|---|
| PubChem CID | 25132256 |
| Molecular Formula | C21H22N4O2 |
| Molecular Weight | 362.43 g/mol |
| Exact Mass | 362.17 |
| IUPAC Name | 4-[[3-(1,4-diazepane-1-carbonyl)phenyl]methyl]-2H-phthalazin-1-one |
| SMILES | O=C(c1cccc(Cc2n[nH]c(=O)c3ccccc23)c1)N1CCCNCC1 |
| InChI | InChI=1S/C21H22N4O2/c26-20-18-8-2-1-7-17(18)19(23-24-20)14-15-5-3-6-16(13-15)21(27)25-11-4-9-22-10-12-25/h1-3,5-8,13,22H,4,9-12,14H2,(H,24,26) |
| InChIKey | QDMIFBVZKVTWSS-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 78.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.43 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |