C20H19FN4O2 — CID 153339064
4-[[3-(1,3-diazinane-1-carbonyl)-4-fluorophenyl]methyl]-2H-phthalazin-1-one (PubChem CID 153339064) has the molecular formula C20H19FN4O2 and a molecular weight of 366.40 g/mol. Its IUPAC name is 4-[[3-(1,3-diazinane-1-carbonyl)-4-fluorophenyl]methyl]-2H-phthalazin-1-one.
| Compound Name | 4-[[3-(1,3-diazinane-1-carbonyl)-4-fluorophenyl]methyl]-2H-phthalazin-1-one |
|---|---|
| PubChem CID | 153339064 |
| Molecular Formula | C20H19FN4O2 |
| Molecular Weight | 366.40 g/mol |
| Exact Mass | 366.15 |
| IUPAC Name | 4-[[3-(1,3-diazinane-1-carbonyl)-4-fluorophenyl]methyl]-2H-phthalazin-1-one |
| SMILES | O=C(c1cc(Cc2n[nH]c(=O)c3ccccc23)ccc1F)N1CCCNC1 |
| InChI | InChI=1S/C20H19FN4O2/c21-17-7-6-13(10-16(17)20(27)25-9-3-8-22-12-25)11-18-14-4-1-2-5-15(14)19(26)24-23-18/h1-2,4-7,10,22H,3,8-9,11-12H2,(H,24,26) |
| InChIKey | VVMNHCDVCCGAMC-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 78.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.40 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |