C26H25FN4O4 — CID 57344118
1-cyclopropyl-2-[4-[2-fluoro-5-[(4-oxo-3H-phthalazin-1-yl)methyl]benzoyl]-1,4-diazepan-1-yl]ethane-1,2-dione (PubChem CID 57344118) has the molecular formula C26H25FN4O4 and a molecular weight of 476.51 g/mol. Its IUPAC name is 1-cyclopropyl-2-[4-[2-fluoro-5-[(4-oxo-3H-phthalazin-1-yl)methyl]benzoyl]-1,4-diazepan-1-yl]ethane-1,2-dione.
| Compound Name | 1-cyclopropyl-2-[4-[2-fluoro-5-[(4-oxo-3H-phthalazin-1-yl)methyl]benzoyl]-1,4-diazepan-1-yl]ethane-1,2-dione |
|---|---|
| PubChem CID | 57344118 |
| Molecular Formula | C26H25FN4O4 |
| Molecular Weight | 476.51 g/mol |
| Exact Mass | 476.19 |
| IUPAC Name | 1-cyclopropyl-2-[4-[2-fluoro-5-[(4-oxo-3H-phthalazin-1-yl)methyl]benzoyl]-1,4-diazepan-1-yl]ethane-1,2-dione |
| SMILES | O=C(C(=O)N1CCCN(C(=O)c2cc(Cc3n[nH]c(=O)c4ccccc34)ccc2F)CC1)C1CC1 |
| InChI | InChI=1S/C26H25FN4O4/c27-21-9-6-16(15-22-18-4-1-2-5-19(18)24(33)29-28-22)14-20(21)25(34)30-10-3-11-31(13-12-30)26(35)23(32)17-7-8-17/h1-2,4-6,9,14,17H,3,7-8,10-13,15H2,(H,29,33) |
| InChIKey | KFPHBEWCZGXGRU-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 103.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.51 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|