C25H22N4O3S — CID 118708496
4-[[4-(4-benzoylpiperazine-1-carbonyl)thiophen-2-yl]methyl]-2H-phthalazin-1-one (PubChem CID 118708496) has the molecular formula C25H22N4O3S and a molecular weight of 458.54 g/mol. Its IUPAC name is 4-[[4-(4-benzoylpiperazine-1-carbonyl)thiophen-2-yl]methyl]-2H-phthalazin-1-one.
| Compound Name | 4-[[4-(4-benzoylpiperazine-1-carbonyl)thiophen-2-yl]methyl]-2H-phthalazin-1-one |
|---|---|
| PubChem CID | 118708496 |
| Molecular Formula | C25H22N4O3S |
| Molecular Weight | 458.54 g/mol |
| Exact Mass | 458.14 |
| IUPAC Name | 4-[[4-(4-benzoylpiperazine-1-carbonyl)thiophen-2-yl]methyl]-2H-phthalazin-1-one |
| SMILES | O=C(c1ccccc1)N1CCN(C(=O)c2csc(Cc3n[nH]c(=O)c4ccccc34)c2)CC1 |
| InChI | InChI=1S/C25H22N4O3S/c30-23-21-9-5-4-8-20(21)22(26-27-23)15-19-14-18(16-33-19)25(32)29-12-10-28(11-13-29)24(31)17-6-2-1-3-7-17/h1-9,14,16H,10-13,15H2,(H,27,30) |
| InChIKey | BIQXBECQDDGBHW-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 86.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.54 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |