C22H19F3N6O2 — CID 123424344
4-[[3-[3-imino-4-(2,2,2-trifluoroethanimidoyl)piperazine-1-carbonyl]phenyl]methyl]-2H-phthalazin-1-one (PubChem CID 123424344) has the molecular formula C22H19F3N6O2 and a molecular weight of 456.43 g/mol. Its IUPAC name is 4-[[3-[3-imino-4-(2,2,2-trifluoroethanimidoyl)piperazine-1-carbonyl]phenyl]methyl]-2H-phthalazin-1-one.
| Compound Name | 4-[[3-[3-imino-4-(2,2,2-trifluoroethanimidoyl)piperazine-1-carbonyl]phenyl]methyl]-2H-phthalazin-1-one |
|---|---|
| PubChem CID | 123424344 |
| Molecular Formula | C22H19F3N6O2 |
| Molecular Weight | 456.43 g/mol |
| Exact Mass | 456.15 |
| IUPAC Name | 4-[[3-[3-imino-4-(2,2,2-trifluoroethanimidoyl)piperazine-1-carbonyl]phenyl]methyl]-2H-phthalazin-1-one |
| SMILES | [H]/N=C1\CN(C(=O)c2cccc(Cc3n[nH]c(=O)c4ccccc34)c2)CCN1/C(=N/[H])C(F)(F)F |
| InChI | InChI=1S/C22H19F3N6O2/c23-22(24,25)21(27)31-9-8-30(12-18(31)26)20(33)14-5-3-4-13(10-14)11-17-15-6-1-2-7-16(15)19(32)29-28-17/h1-7,10,26-27H,8-9,11-12H2,(H,29,32)/b26-18+,27-21+ |
| InChIKey | GRKDEXTWPNARIE-WUXNSVGLSA-N |
| XLogP | 2.79 |
| TPSA | 117.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.43 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|