C23H22F2N6O2 — CID 123269411
4-[[4-fluoro-3-[4-(2-fluoropropanimidoyl)-3-iminopiperazine-1-carbonyl]phenyl]methyl]-2H-phthalazin-1-one (PubChem CID 123269411) has the molecular formula C23H22F2N6O2 and a molecular weight of 452.47 g/mol. Its IUPAC name is 4-[[4-fluoro-3-[4-(2-fluoropropanimidoyl)-3-iminopiperazine-1-carbonyl]phenyl]methyl]-2H-phthalazin-1-one.
| Compound Name | 4-[[4-fluoro-3-[4-(2-fluoropropanimidoyl)-3-iminopiperazine-1-carbonyl]phenyl]methyl]-2H-phthalazin-1-one |
|---|---|
| PubChem CID | 123269411 |
| Molecular Formula | C23H22F2N6O2 |
| Molecular Weight | 452.47 g/mol |
| Exact Mass | 452.18 |
| IUPAC Name | 4-[[4-fluoro-3-[4-(2-fluoropropanimidoyl)-3-iminopiperazine-1-carbonyl]phenyl]methyl]-2H-phthalazin-1-one |
| SMILES | [H]/N=C1\CN(C(=O)c2cc(Cc3n[nH]c(=O)c4ccccc34)ccc2F)CCN1/C(=N/[H])C(C)F |
| InChI | InChI=1S/C23H22F2N6O2/c1-13(24)21(27)31-9-8-30(12-20(31)26)23(33)17-10-14(6-7-18(17)25)11-19-15-4-2-3-5-16(15)22(32)29-28-19/h2-7,10,13,26-27H,8-9,11-12H2,1H3,(H,29,32)/b26-20+,27-21+ |
| InChIKey | OOBQFGNQNHPHBB-CRYYDKFDSA-N |
| XLogP | 2.72 |
| TPSA | 117.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.47 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|