C26H35FN6O3S2 — CID 176580894
CID 176580894 (PubChem CID 176580894) has the molecular formula C26H35FN6O3S2 and a molecular weight of 562.74 g/mol.
| Compound Name | CID 176580894 |
|---|---|
| PubChem CID | 176580894 |
| Molecular Formula | C26H35FN6O3S2 |
| Molecular Weight | 562.74 g/mol |
| Exact Mass | 562.22 |
| IUPAC Name | — |
| SMILES | CC.NCCNCC(=O)N1CCN(C(=O)c2cc(Cc3n[nH]c(=O)c4ccccc34)ccc2F)CC1.SS |
| InChI | InChI=1S/C24H27FN6O3.C2H6.H2S2/c25-20-6-5-16(14-21-17-3-1-2-4-18(17)23(33)29-28-21)13-19(20)24(34)31-11-9-30(10-12-31)22(32)15-27-8-7-26;2*1-2/h1-6,13,27H,7-12,14-15,26H2,(H,29,33);1-2H3;1-2H |
| InChIKey | PTLNCJZCVIFXSZ-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 124.42 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.74 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|