C34H45FN6O5 — CID 176578546
tert-butyl N-[7-[[2-[4-[2-fluoro-5-[(4-oxo-3H-phthalazin-1-yl)methyl]benzoyl]piperazin-1-yl]-2-oxoethyl]amino]heptyl]carbamate (PubChem CID 176578546) has the molecular formula C34H45FN6O5 and a molecular weight of 636.77 g/mol. Its IUPAC name is tert-butyl N-[7-[[2-[4-[2-fluoro-5-[(4-oxo-3H-phthalazin-1-yl)methyl]benzoyl]piperazin-1-yl]-2-oxoethyl]amino]heptyl]carbamate.
| Compound Name | tert-butyl N-[7-[[2-[4-[2-fluoro-5-[(4-oxo-3H-phthalazin-1-yl)methyl]benzoyl]piperazin-1-yl]-2-oxoethyl]amino]heptyl]carbamate |
|---|---|
| PubChem CID | 176578546 |
| Molecular Formula | C34H45FN6O5 |
| Molecular Weight | 636.77 g/mol |
| Exact Mass | 636.34 |
| IUPAC Name | tert-butyl N-[7-[[2-[4-[2-fluoro-5-[(4-oxo-3H-phthalazin-1-yl)methyl]benzoyl]piperazin-1-yl]-2-oxoethyl]amino]heptyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCCCCCCNCC(=O)N1CCN(C(=O)c2cc(Cc3n[nH]c(=O)c4ccccc34)ccc2F)CC1 |
| InChI | InChI=1S/C34H45FN6O5/c1-34(2,3)46-33(45)37-16-10-6-4-5-9-15-36-23-30(42)40-17-19-41(20-18-40)32(44)27-21-24(13-14-28(27)35)22-29-25-11-7-8-12-26(25)31(43)39-38-29/h7-8,11-14,21,36H,4-6,9-10,15-20,22-23H2,1-3H3,(H,37,45)(H,39,43) |
| InChIKey | LFSIXFUNGXSCHL-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 136.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.77 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|