C26H31FN4O4 — CID 155723297
tert-butyl formate;4-[[4-fluoro-3-(4-methylpiperazine-1-carbonyl)phenyl]methyl]-2H-phthalazin-1-one (PubChem CID 155723297) has the molecular formula C26H31FN4O4 and a molecular weight of 482.56 g/mol. Its IUPAC name is tert-butyl formate;4-[[4-fluoro-3-(4-methylpiperazine-1-carbonyl)phenyl]methyl]-2H-phthalazin-1-one.
| Compound Name | tert-butyl formate;4-[[4-fluoro-3-(4-methylpiperazine-1-carbonyl)phenyl]methyl]-2H-phthalazin-1-one |
|---|---|
| PubChem CID | 155723297 |
| Molecular Formula | C26H31FN4O4 |
| Molecular Weight | 482.56 g/mol |
| Exact Mass | 482.23 |
| IUPAC Name | tert-butyl formate;4-[[4-fluoro-3-(4-methylpiperazine-1-carbonyl)phenyl]methyl]-2H-phthalazin-1-one |
| SMILES | CC(C)(C)OC=O.CN1CCN(C(=O)c2cc(Cc3n[nH]c(=O)c4ccccc34)ccc2F)CC1 |
| InChI | InChI=1S/C21H21FN4O2.C5H10O2/c1-25-8-10-26(11-9-25)21(28)17-12-14(6-7-18(17)22)13-19-15-4-2-3-5-16(15)20(27)24-23-19;1-5(2,3)7-4-6/h2-7,12H,8-11,13H2,1H3,(H,24,27);4H,1-3H3 |
| InChIKey | DEJSRXPFBWOZFH-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 95.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.56 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|