C25H28FN3O3 — CID 70255977
4-[[4-fluoro-3-[4-(3-methoxypropyl)piperidine-1-carbonyl]phenyl]methyl]-2H-phthalazin-1-one (PubChem CID 70255977) has the molecular formula C25H28FN3O3 and a molecular weight of 437.52 g/mol. Its IUPAC name is 4-[[4-fluoro-3-[4-(3-methoxypropyl)piperidine-1-carbonyl]phenyl]methyl]-2H-phthalazin-1-one.
| Compound Name | 4-[[4-fluoro-3-[4-(3-methoxypropyl)piperidine-1-carbonyl]phenyl]methyl]-2H-phthalazin-1-one |
|---|---|
| PubChem CID | 70255977 |
| Molecular Formula | C25H28FN3O3 |
| Molecular Weight | 437.52 g/mol |
| Exact Mass | 437.21 |
| IUPAC Name | 4-[[4-fluoro-3-[4-(3-methoxypropyl)piperidine-1-carbonyl]phenyl]methyl]-2H-phthalazin-1-one |
| SMILES | COCCCC1CCN(C(=O)c2cc(Cc3n[nH]c(=O)c4ccccc34)ccc2F)CC1 |
| InChI | InChI=1S/C25H28FN3O3/c1-32-14-4-5-17-10-12-29(13-11-17)25(31)21-15-18(8-9-22(21)26)16-23-19-6-2-3-7-20(19)24(30)28-27-23/h2-3,6-9,15,17H,4-5,10-14,16H2,1H3,(H,28,30) |
| InChIKey | YKOBLSVDDGAFCM-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 75.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.52 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|