C25H19N3O3 — CID 91505684
4-[[3-(2,5-dihydroxy-3-phenylpyrrol-1-yl)phenyl]methyl]-2H-phthalazin-1-one (PubChem CID 91505684) has the molecular formula C25H19N3O3 and a molecular weight of 409.45 g/mol. Its IUPAC name is 4-[[3-(2,5-dihydroxy-3-phenylpyrrol-1-yl)phenyl]methyl]-2H-phthalazin-1-one.
| Compound Name | 4-[[3-(2,5-dihydroxy-3-phenylpyrrol-1-yl)phenyl]methyl]-2H-phthalazin-1-one |
|---|---|
| PubChem CID | 91505684 |
| Molecular Formula | C25H19N3O3 |
| Molecular Weight | 409.45 g/mol |
| Exact Mass | 409.14 |
| IUPAC Name | 4-[[3-(2,5-dihydroxy-3-phenylpyrrol-1-yl)phenyl]methyl]-2H-phthalazin-1-one |
| SMILES | O=c1[nH]nc(Cc2cccc(-n3c(O)cc(-c4ccccc4)c3O)c2)c2ccccc12 |
| InChI | InChI=1S/C25H19N3O3/c29-23-15-21(17-8-2-1-3-9-17)25(31)28(23)18-10-6-7-16(13-18)14-22-19-11-4-5-12-20(19)24(30)27-26-22/h1-13,15,29,31H,14H2,(H,27,30) |
| InChIKey | PNXZIHGBQQPOAI-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 91.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.45 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |