C20H15N3O — CID 54588295
4-benzyl-6-pyridin-3-yl-2H-phthalazin-1-one (PubChem CID 54588295) has the molecular formula C20H15N3O and a molecular weight of 313.36 g/mol. Its IUPAC name is 4-benzyl-6-pyridin-3-yl-2H-phthalazin-1-one.
| Compound Name | 4-benzyl-6-pyridin-3-yl-2H-phthalazin-1-one |
|---|---|
| PubChem CID | 54588295 |
| Molecular Formula | C20H15N3O |
| Molecular Weight | 313.36 g/mol |
| Exact Mass | 313.12 |
| IUPAC Name | 4-benzyl-6-pyridin-3-yl-2H-phthalazin-1-one |
| SMILES | O=c1[nH]nc(Cc2ccccc2)c2cc(-c3cccnc3)ccc12 |
| InChI | InChI=1S/C20H15N3O/c24-20-17-9-8-15(16-7-4-10-21-13-16)12-18(17)19(22-23-20)11-14-5-2-1-3-6-14/h1-10,12-13H,11H2,(H,23,24) |
| InChIKey | KUESCWPDIBQBSC-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.36 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |