C22H19N5O2 — CID 69152090
1-[1-[(3-methylphenyl)methyl]-4-oxo-3H-phthalazin-6-yl]-3-pyridin-3-ylurea (PubChem CID 69152090) has the molecular formula C22H19N5O2 and a molecular weight of 385.43 g/mol. Its IUPAC name is 1-[1-[(3-methylphenyl)methyl]-4-oxo-3H-phthalazin-6-yl]-3-pyridin-3-ylurea.
| Compound Name | 1-[1-[(3-methylphenyl)methyl]-4-oxo-3H-phthalazin-6-yl]-3-pyridin-3-ylurea |
|---|---|
| PubChem CID | 69152090 |
| Molecular Formula | C22H19N5O2 |
| Molecular Weight | 385.43 g/mol |
| Exact Mass | 385.15 |
| IUPAC Name | 1-[1-[(3-methylphenyl)methyl]-4-oxo-3H-phthalazin-6-yl]-3-pyridin-3-ylurea |
| SMILES | Cc1cccc(Cc2n[nH]c(=O)c3cc(NC(=O)Nc4cccnc4)ccc23)c1 |
| InChI | InChI=1S/C22H19N5O2/c1-14-4-2-5-15(10-14)11-20-18-8-7-16(12-19(18)21(28)27-26-20)24-22(29)25-17-6-3-9-23-13-17/h2-10,12-13H,11H2,1H3,(H,27,28)(H2,24,25,29) |
| InChIKey | SQTRJZBBYDJETJ-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 99.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.43 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |