C26H21N5O2 — CID 69152197
1-(4-methylphenyl)-3-[4-oxo-1-(quinolin-3-ylmethyl)-3H-phthalazin-6-yl]urea (PubChem CID 69152197) has the molecular formula C26H21N5O2 and a molecular weight of 435.49 g/mol. Its IUPAC name is 1-(4-methylphenyl)-3-[4-oxo-1-(quinolin-3-ylmethyl)-3H-phthalazin-6-yl]urea.
| Compound Name | 1-(4-methylphenyl)-3-[4-oxo-1-(quinolin-3-ylmethyl)-3H-phthalazin-6-yl]urea |
|---|---|
| PubChem CID | 69152197 |
| Molecular Formula | C26H21N5O2 |
| Molecular Weight | 435.49 g/mol |
| Exact Mass | 435.17 |
| IUPAC Name | 1-(4-methylphenyl)-3-[4-oxo-1-(quinolin-3-ylmethyl)-3H-phthalazin-6-yl]urea |
| SMILES | Cc1ccc(NC(=O)Nc2ccc3c(Cc4cnc5ccccc5c4)n[nH]c(=O)c3c2)cc1 |
| InChI | InChI=1S/C26H21N5O2/c1-16-6-8-19(9-7-16)28-26(33)29-20-10-11-21-22(14-20)25(32)31-30-24(21)13-17-12-18-4-2-3-5-23(18)27-15-17/h2-12,14-15H,13H2,1H3,(H,31,32)(H2,28,29,33) |
| InChIKey | SOFVHBNGENJJRB-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 99.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.49 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |