C22H20N4O4 — CID 69152530
ethyl 4-[[1-[(4-cyanophenyl)methyl]-4-oxo-3H-phthalazin-6-yl]amino]-4-oxobutanoate (PubChem CID 69152530) has the molecular formula C22H20N4O4 and a molecular weight of 404.43 g/mol. Its IUPAC name is ethyl 4-[[1-[(4-cyanophenyl)methyl]-4-oxo-3H-phthalazin-6-yl]amino]-4-oxobutanoate.
| Compound Name | ethyl 4-[[1-[(4-cyanophenyl)methyl]-4-oxo-3H-phthalazin-6-yl]amino]-4-oxobutanoate |
|---|---|
| PubChem CID | 69152530 |
| Molecular Formula | C22H20N4O4 |
| Molecular Weight | 404.43 g/mol |
| Exact Mass | 404.15 |
| IUPAC Name | ethyl 4-[[1-[(4-cyanophenyl)methyl]-4-oxo-3H-phthalazin-6-yl]amino]-4-oxobutanoate |
| SMILES | CCOC(=O)CCC(=O)Nc1ccc2c(Cc3ccc(C#N)cc3)n[nH]c(=O)c2c1 |
| InChI | InChI=1S/C22H20N4O4/c1-2-30-21(28)10-9-20(27)24-16-7-8-17-18(12-16)22(29)26-25-19(17)11-14-3-5-15(13-23)6-4-14/h3-8,12H,2,9-11H2,1H3,(H,24,27)(H,26,29) |
| InChIKey | SPDPYQBICASRFC-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 124.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.43 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |