C13H10N4O — CID 10799933
4-(pyridin-4-ylmethyl)-2H-pyrido[3,4-d]pyridazin-1-one (PubChem CID 10799933) has the molecular formula C13H10N4O and a molecular weight of 238.25 g/mol. Its IUPAC name is 4-(pyridin-4-ylmethyl)-2H-pyrido[3,4-d]pyridazin-1-one.
| Compound Name | 4-(pyridin-4-ylmethyl)-2H-pyrido[3,4-d]pyridazin-1-one |
|---|---|
| PubChem CID | 10799933 |
| Molecular Formula | C13H10N4O |
| Molecular Weight | 238.25 g/mol |
| Exact Mass | 238.09 |
| IUPAC Name | 4-(pyridin-4-ylmethyl)-2H-pyrido[3,4-d]pyridazin-1-one |
| SMILES | O=c1[nH]nc(Cc2ccncc2)c2cnccc12 |
| InChI | InChI=1S/C13H10N4O/c18-13-10-3-6-15-8-11(10)12(16-17-13)7-9-1-4-14-5-2-9/h1-6,8H,7H2,(H,17,18) |
| InChIKey | OCGINFQZBOVZBZ-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.25 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |