C19H18O3S — CID 101351311
(1E,4E)-2-(benzenesulfonyl)-4-methyl-1-phenylhexa-1,4-dien-3-one (PubChem CID 101351311) has the molecular formula C19H18O3S and a molecular weight of 326.42 g/mol. Its IUPAC name is (1E,4E)-2-(benzenesulfonyl)-4-methyl-1-phenylhexa-1,4-dien-3-one.
| Compound Name | (1E,4E)-2-(benzenesulfonyl)-4-methyl-1-phenylhexa-1,4-dien-3-one |
|---|---|
| PubChem CID | 101351311 |
| Molecular Formula | C19H18O3S |
| Molecular Weight | 326.42 g/mol |
| Exact Mass | 326.10 |
| IUPAC Name | (1E,4E)-2-(benzenesulfonyl)-4-methyl-1-phenylhexa-1,4-dien-3-one |
| SMILES | C/C=C(\C)C(=O)/C(=C\c1ccccc1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C19H18O3S/c1-3-15(2)19(20)18(14-16-10-6-4-7-11-16)23(21,22)17-12-8-5-9-13-17/h3-14H,1-2H3/b15-3+,18-14+ |
| InChIKey | AKHQBSQZJSZSOA-RAFNJNKBSA-N |
| XLogP | 4.04 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.42 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|